C25H17ClN4O3S — CID 17114865
5-(4-chlorophenyl)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17114865) has the molecular formula C25H17ClN4O3S and a molecular weight of 488.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17114865 |
| Molecular Formula | C25H17ClN4O3S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1cc(-c2nc3ncccc3o2)ccc1NC(=S)NC(=O)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H17ClN4O3S/c1-14-13-16(24-29-22-20(33-24)3-2-12-27-22)6-9-18(14)28-25(34)30-23(31)21-11-10-19(32-21)15-4-7-17(26)8-5-15/h2-13H,1H3,(H2,28,30,31,34) |
| InChIKey | NKPIJBGAVVGQKA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|