C23H18Cl2N4O3S — CID 2953610
2-(2,4-dichlorophenoxy)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide (PubChem CID 2953610) has the molecular formula C23H18Cl2N4O3S and a molecular weight of 501.40 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 2953610 |
| Molecular Formula | C23H18Cl2N4O3S |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[[2-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]propanamide |
| SMILES | Cc1cc(-c2nc3ncccc3o2)ccc1NC(=S)NC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N4O3S/c1-12-10-14(22-28-20-19(32-22)4-3-9-26-20)5-7-17(12)27-23(33)29-21(30)13(2)31-18-8-6-15(24)11-16(18)25/h3-11,13H,1-2H3,(H2,27,29,30,33) |
| InChIKey | VCSJDZRCISZGQF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|