C24H18Cl3N3O3S — CID 4045497
N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4045497) has the molecular formula C24H18Cl3N3O3S and a molecular weight of 534.85 g/mol. Its IUPAC name is N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4045497 |
| Molecular Formula | C24H18Cl3N3O3S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | N-[[2-(3-chloro-4-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | Cc1ccc(-c2nc3cc(NC(=S)NC(=O)C(C)Oc4ccc(Cl)cc4Cl)ccc3o2)cc1Cl |
| InChI | InChI=1S/C24H18Cl3N3O3S/c1-12-3-4-14(9-17(12)26)23-29-19-11-16(6-8-21(19)33-23)28-24(34)30-22(31)13(2)32-20-7-5-15(25)10-18(20)27/h3-11,13H,1-2H3,(H2,28,30,31,34) |
| InChIKey | ZMALSWKNZFHCMD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|