C23H16Cl2FN3O3S — CID 4647669
2-(2,4-dichlorophenoxy)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide (PubChem CID 4647669) has the molecular formula C23H16Cl2FN3O3S and a molecular weight of 504.37 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 4647669 |
| Molecular Formula | C23H16Cl2FN3O3S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccc2oc(-c3ccccc3F)nc2c1 |
| InChI | InChI=1S/C23H16Cl2FN3O3S/c1-12(31-19-8-6-13(24)10-16(19)25)21(30)29-23(33)27-14-7-9-20-18(11-14)28-22(32-20)15-4-2-3-5-17(15)26/h2-12H,1H3,(H2,27,29,30,33) |
| InChIKey | PPYHNLXGNLDYKE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|