C23H16Cl3N3O2S2 — CID 3334302
N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 3334302) has the molecular formula C23H16Cl3N3O2S2 and a molecular weight of 536.89 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 3334302 |
| Molecular Formula | C23H16Cl3N3O2S2 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 534.97 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C23H16Cl3N3O2S2/c1-12(31-19-9-6-13(24)10-17(19)26)21(30)29-23(32)27-14-7-8-16(25)15(11-14)22-28-18-4-2-3-5-20(18)33-22/h2-12H,1H3,(H2,27,29,30,32) |
| InChIKey | HSSBXLCORWRQFV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|