C23H16BrCl2N3O3S — CID 3368095
N-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 3368095) has the molecular formula C23H16BrCl2N3O3S and a molecular weight of 565.28 g/mol. Its IUPAC name is N-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 3368095 |
| Molecular Formula | C23H16BrCl2N3O3S |
| Molecular Weight | 565.28 g/mol |
| Exact Mass | 562.95 |
| IUPAC Name | N-[[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccc2oc(-c3ccccc3Br)nc2c1 |
| InChI | InChI=1S/C23H16BrCl2N3O3S/c1-12(31-19-8-6-13(25)10-17(19)26)21(30)29-23(33)27-14-7-9-20-18(11-14)28-22(32-20)15-4-2-3-5-16(15)24/h2-12H,1H3,(H2,27,29,30,33) |
| InChIKey | IPMPAXIUEGKBHD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.28 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|