C16H12Br2Cl2N2O3S — CID 5137130
N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 5137130) has the molecular formula C16H12Br2Cl2N2O3S and a molecular weight of 543.06 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 5137130 |
| Molecular Formula | C16H12Br2Cl2N2O3S |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 539.83 |
| IUPAC Name | N-[(3,5-dibromo-4-hydroxyphenyl)carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C16H12Br2Cl2N2O3S/c1-7(25-13-3-2-8(19)4-12(13)20)15(24)22-16(26)21-9-5-10(17)14(23)11(18)6-9/h2-7,23H,1H3,(H2,21,22,24,26) |
| InChIKey | XKCWJIYLNFSSJQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|