C21H17Cl2N3O3S2 — CID 4204410
N-[4-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]thiophene-2-carboxamide (PubChem CID 4204410) has the molecular formula C21H17Cl2N3O3S2 and a molecular weight of 494.43 g/mol. Its IUPAC name is N-[4-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4204410 |
| Molecular Formula | C21H17Cl2N3O3S2 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | N-[4-[2-(2,4-dichlorophenoxy)propanoylcarbamothioylamino]phenyl]thiophene-2-carboxamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)Nc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O3S2/c1-12(29-17-9-4-13(22)11-16(17)23)19(27)26-21(30)25-15-7-5-14(6-8-15)24-20(28)18-3-2-10-31-18/h2-12H,1H3,(H,24,28)(H2,25,26,27,30) |
| InChIKey | VGWWTESNBVRUHQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|