C24H23Cl2N3O5S2 — CID 5194289
2-(2,4-dichlorophenoxy)-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]propanamide (PubChem CID 5194289) has the molecular formula C24H23Cl2N3O5S2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 5194289 |
| Molecular Formula | C24H23Cl2N3O5S2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]propanamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)Oc3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O5S2/c1-3-33-19-9-5-18(6-10-19)29-36(31,32)20-11-7-17(8-12-20)27-24(35)28-23(30)15(2)34-22-13-4-16(25)14-21(22)26/h4-15,29H,3H2,1-2H3,(H2,27,28,30,35) |
| InChIKey | WISXGEMHCVJAMJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|