C21H13BrCl2N2O3 — CID 17117177
N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,5-dichloro-2-methoxybenzamide (PubChem CID 17117177) has the molecular formula C21H13BrCl2N2O3 and a molecular weight of 492.16 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,5-dichloro-2-methoxybenzamide.
| Compound Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,5-dichloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 17117177 |
| Molecular Formula | C21H13BrCl2N2O3 |
| Molecular Weight | 492.16 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,5-dichloro-2-methoxybenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)Nc1ccc2oc(-c3ccccc3Br)nc2c1 |
| InChI | InChI=1S/C21H13BrCl2N2O3/c1-28-19-14(8-11(23)9-16(19)24)20(27)25-12-6-7-18-17(10-12)26-21(29-18)13-4-2-3-5-15(13)22/h2-10H,1H3,(H,25,27) |
| InChIKey | HXOVOERLZLLYCK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.16 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |