C20H11BrCl2N2O2 — CID 3998301
N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,4-dichlorobenzamide (PubChem CID 3998301) has the molecular formula C20H11BrCl2N2O2 and a molecular weight of 462.13 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3998301 |
| Molecular Formula | C20H11BrCl2N2O2 |
| Molecular Weight | 462.13 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc2oc(-c3ccccc3Br)nc2c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H11BrCl2N2O2/c21-14-4-2-1-3-13(14)20-25-17-10-12(6-8-18(17)27-20)24-19(26)11-5-7-15(22)16(23)9-11/h1-10H,(H,24,26) |
| InChIKey | DKBSUOFZCRPOKI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.13 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |