C21H14BrClN2O2 — CID 23731964
N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3-chloro-4-methylbenzamide (PubChem CID 23731964) has the molecular formula C21H14BrClN2O2 and a molecular weight of 441.71 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3-chloro-4-methylbenzamide.
| Compound Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 23731964 |
| Molecular Formula | C21H14BrClN2O2 |
| Molecular Weight | 441.71 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | N-[2-(2-bromophenyl)-1,3-benzoxazol-5-yl]-3-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3oc(-c4ccccc4Br)nc3c2)cc1Cl |
| InChI | InChI=1S/C21H14BrClN2O2/c1-12-6-7-13(10-17(12)23)20(26)24-14-8-9-19-18(11-14)25-21(27-19)15-4-2-3-5-16(15)22/h2-11H,1H3,(H,24,26) |
| InChIKey | FUIMWJUZMOXNTB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |