C24H19Cl2N3O3S — CID 3510655
2-(2,4-dichlorophenoxy)-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]propanamide (PubChem CID 3510655) has the molecular formula C24H19Cl2N3O3S and a molecular weight of 500.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 3510655 |
| Molecular Formula | C24H19Cl2N3O3S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]propanamide |
| SMILES | Cc1ccc2oc(-c3ccc(NC(=S)NC(=O)C(C)Oc4ccc(Cl)cc4Cl)cc3)nc2c1 |
| InChI | InChI=1S/C24H19Cl2N3O3S/c1-13-3-9-21-19(11-13)28-23(32-21)15-4-7-17(8-5-15)27-24(33)29-22(30)14(2)31-20-10-6-16(25)12-18(20)26/h3-12,14H,1-2H3,(H2,27,29,30,33) |
| InChIKey | AOAGUCYFUGVZBS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|