C24H19Cl2N3O3S2 — CID 4664403
N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4664403) has the molecular formula C24H19Cl2N3O3S2 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4664403 |
| Molecular Formula | C24H19Cl2N3O3S2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | Cc1cc(NC(=S)NC(=O)C(C)Oc2ccc(Cl)cc2Cl)cc(-c2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C24H19Cl2N3O3S2/c1-12-9-15(11-16(21(12)30)23-28-18-5-3-4-6-20(18)34-23)27-24(33)29-22(31)13(2)32-19-8-7-14(25)10-17(19)26/h3-11,13,30H,1-2H3,(H2,27,29,31,33) |
| InChIKey | FDJMXSSTODJIOA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|