C24H17Cl2N3O2S2 — CID 135775801
(E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 135775801) has the molecular formula C24H17Cl2N3O2S2 and a molecular weight of 514.46 g/mol. Its IUPAC name is (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135775801 |
| Molecular Formula | C24H17Cl2N3O2S2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=S)NC(=O)/C=C/c2ccc(Cl)cc2Cl)cc(-c2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C24H17Cl2N3O2S2/c1-13-10-16(12-17(22(13)31)23-28-19-4-2-3-5-20(19)33-23)27-24(32)29-21(30)9-7-14-6-8-15(25)11-18(14)26/h2-12,31H,1H3,(H2,27,29,30,32)/b9-7+ |
| InChIKey | GNFKRNDRZDRZRW-VQHVLOKHSA-N |
| XLogP | 6.81 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|