C19H20N2O2S — CID 135477376
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]-2,2-dimethylpropanamide (PubChem CID 135477376) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 135477376 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxy-5-methylphenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)cc(-c2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C19H20N2O2S/c1-11-9-12(20-18(23)19(2,3)4)10-13(16(11)22)17-21-14-7-5-6-8-15(14)24-17/h5-10,22H,1-4H3,(H,20,23) |
| InChIKey | LVXLKSZFZBFQHO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|