C21H17N3OS — CID 123563775
4-amino-N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-methylbenzamide (PubChem CID 123563775) has the molecular formula C21H17N3OS and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-methylbenzamide.
| Compound Name | 4-amino-N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 123563775 |
| Molecular Formula | C21H17N3OS |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-amino-N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2-c2nc3ccccc3s2)ccc1N |
| InChI | InChI=1S/C21H17N3OS/c1-13-12-14(10-11-16(13)22)20(25)23-17-7-3-2-6-15(17)21-24-18-8-4-5-9-19(18)26-21/h2-12H,22H2,1H3,(H,23,25) |
| InChIKey | XOHKNKZLIMVSLT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|