C27H16N2O4S2 — CID 26181584
N-[2-(1,3-benzothiazol-2-yl)phenyl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 26181584) has the molecular formula C27H16N2O4S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 26181584 |
| Molecular Formula | C27H16N2O4S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2s1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H16N2O4S2/c30-25-18-8-2-6-12-23(18)35(32,33)24-15-16(13-14-19(24)25)26(31)28-20-9-3-1-7-17(20)27-29-21-10-4-5-11-22(21)34-27/h1-15H,(H,28,31) |
| InChIKey | KLTNNEFDFNGOPC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |