C22H15NO5S — CID 7945387
N-(4-acetylphenyl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 7945387) has the molecular formula C22H15NO5S and a molecular weight of 405.43 g/mol. Its IUPAC name is N-(4-acetylphenyl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 7945387 |
| Molecular Formula | C22H15NO5S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-(4-acetylphenyl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc3c(c2)S(=O)(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H15NO5S/c1-13(24)14-6-9-16(10-7-14)23-22(26)15-8-11-18-20(12-15)29(27,28)19-5-3-2-4-17(19)21(18)25/h2-12H,1H3,(H,23,26) |
| InChIKey | PXQAIUNBDASTGV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |