C25H19N3O4S — CID 154834472
N-(2-cyclobutyl-3H-benzimidazol-5-yl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 154834472) has the molecular formula C25H19N3O4S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-(2-cyclobutyl-3H-benzimidazol-5-yl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(2-cyclobutyl-3H-benzimidazol-5-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 154834472 |
| Molecular Formula | C25H19N3O4S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-(2-cyclobutyl-3H-benzimidazol-5-yl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc(C3CCC3)[nH]c2c1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H19N3O4S/c29-23-17-6-1-2-7-21(17)33(31,32)22-12-15(8-10-18(22)23)25(30)26-16-9-11-19-20(13-16)28-24(27-19)14-4-3-5-14/h1-2,6-14H,3-5H2,(H,26,30)(H,27,28) |
| InChIKey | IWWRITSGIHVLBE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |