C16H15N3O2 — CID 52827537
N-(2-cyclobutyl-3H-benzimidazol-5-yl)furan-3-carboxamide (PubChem CID 52827537) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-(2-cyclobutyl-3H-benzimidazol-5-yl)furan-3-carboxamide.
| Compound Name | N-(2-cyclobutyl-3H-benzimidazol-5-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 52827537 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-cyclobutyl-3H-benzimidazol-5-yl)furan-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc(C3CCC3)[nH]c2c1)c1ccoc1 |
| InChI | InChI=1S/C16H15N3O2/c20-16(11-6-7-21-9-11)17-12-4-5-13-14(8-12)19-15(18-13)10-2-1-3-10/h4-10H,1-3H2,(H,17,20)(H,18,19) |
| InChIKey | OPXRIMLZOURSSR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |