C19H21N3O3 — CID 167922413
(1R,4S)-4-[(2-cyclohexyl-3H-benzimidazol-5-yl)carbamoyl]cyclobut-2-ene-1-carboxylic acid (PubChem CID 167922413) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (1R,4S)-4-[(2-cyclohexyl-3H-benzimidazol-5-yl)carbamoyl]cyclobut-2-ene-1-carboxylic acid.
| Compound Name | (1R,4S)-4-[(2-cyclohexyl-3H-benzimidazol-5-yl)carbamoyl]cyclobut-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 167922413 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (1R,4S)-4-[(2-cyclohexyl-3H-benzimidazol-5-yl)carbamoyl]cyclobut-2-ene-1-carboxylic acid |
| SMILES | O=C(Nc1ccc2nc(C3CCCCC3)[nH]c2c1)[C@H]1C=C[C@H]1C(=O)O |
| InChI | InChI=1S/C19H21N3O3/c23-18(13-7-8-14(13)19(24)25)20-12-6-9-15-16(10-12)22-17(21-15)11-4-2-1-3-5-11/h6-11,13-14H,1-5H2,(H,20,23)(H,21,22)(H,24,25)/t13-,14+/m0/s1 |
| InChIKey | KNFSIFNLRDTYOL-UONOGXRCSA-N |
| XLogP | 3.44 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|