C21H19F4N3O — CID 118096469
N-(2-cyclohexyl-3H-benzimidazol-5-yl)-2-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 118096469) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is N-(2-cyclohexyl-3H-benzimidazol-5-yl)-2-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-cyclohexyl-3H-benzimidazol-5-yl)-2-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118096469 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(2-cyclohexyl-3H-benzimidazol-5-yl)-2-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc2nc(C3CCCCC3)[nH]c2c1)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C21H19F4N3O/c22-16-10-13(21(23,24)25)6-8-15(16)20(29)26-14-7-9-17-18(11-14)28-19(27-17)12-4-2-1-3-5-12/h6-12H,1-5H2,(H,26,29)(H,27,28) |
| InChIKey | NTRVVUHBADXYHB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |