C23H30N4O2 — CID 118096520
N-(2-cyclohexyl-3H-benzimidazol-5-yl)-3-methoxybenzamide;N-methylmethanamine (PubChem CID 118096520) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(2-cyclohexyl-3H-benzimidazol-5-yl)-3-methoxybenzamide;N-methylmethanamine.
| Compound Name | N-(2-cyclohexyl-3H-benzimidazol-5-yl)-3-methoxybenzamide;N-methylmethanamine |
|---|---|
| PubChem CID | 118096520 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-(2-cyclohexyl-3H-benzimidazol-5-yl)-3-methoxybenzamide;N-methylmethanamine |
| SMILES | CNC.COc1cccc(C(=O)Nc2ccc3nc(C4CCCCC4)[nH]c3c2)c1 |
| InChI | InChI=1S/C21H23N3O2.C2H7N/c1-26-17-9-5-8-15(12-17)21(25)22-16-10-11-18-19(13-16)24-20(23-18)14-6-3-2-4-7-14;1-3-2/h5,8-14H,2-4,6-7H2,1H3,(H,22,25)(H,23,24);3H,1-2H3 |
| InChIKey | OBAVIDACRIRKMY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |