C16H13N3O4 — CID 46249095
N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-methoxybenzamide (PubChem CID 46249095) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-methoxybenzamide.
| Compound Name | N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 46249095 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3[nH]c(=O)c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C16H13N3O4/c1-23-11-4-2-3-9(7-11)14(20)17-10-5-6-12-13(8-10)19-16(22)15(21)18-12/h2-8H,1H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | HQDSWBGDILKXOE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|