C25H21N3O5 — CID 136727404
2-[2-hydroxy-2-(3-methoxyphenyl)ethenyl]-N-(4-methoxyphenyl)-3-oxo-4H-quinoxaline-6-carboxamide (PubChem CID 136727404) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[2-hydroxy-2-(3-methoxyphenyl)ethenyl]-N-(4-methoxyphenyl)-3-oxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 2-[2-hydroxy-2-(3-methoxyphenyl)ethenyl]-N-(4-methoxyphenyl)-3-oxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 136727404 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-[2-hydroxy-2-(3-methoxyphenyl)ethenyl]-N-(4-methoxyphenyl)-3-oxo-4H-quinoxaline-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3nc(C=C(O)c4cccc(OC)c4)c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-32-18-9-7-17(8-10-18)26-24(30)16-6-11-20-21(13-16)28-25(31)22(27-20)14-23(29)15-4-3-5-19(12-15)33-2/h3-14,29H,1-2H3,(H,26,30)(H,28,31) |
| InChIKey | CYUDRFHDGGGRKX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|