C25H20FN3O4 — CID 135949220
N-[(4-fluorophenyl)methyl]-2-[(Z)-2-hydroxy-2-(3-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide (PubChem CID 135949220) has the molecular formula C25H20FN3O4 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(Z)-2-hydroxy-2-(3-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(Z)-2-hydroxy-2-(3-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 135949220 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(Z)-2-hydroxy-2-(3-methoxyphenyl)ethenyl]-3-oxo-4H-quinoxaline-6-carboxamide |
| SMILES | COc1cccc(/C(O)=C/c2nc3ccc(C(=O)NCc4ccc(F)cc4)cc3[nH]c2=O)c1 |
| InChI | InChI=1S/C25H20FN3O4/c1-33-19-4-2-3-16(11-19)23(30)13-22-25(32)29-21-12-17(7-10-20(21)28-22)24(31)27-14-15-5-8-18(26)9-6-15/h2-13,30H,14H2,1H3,(H,27,31)(H,29,32)/b23-13- |
| InChIKey | MJHMWMQQWSUVHT-QRVIBDJDSA-N |
| XLogP | 4.06 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|