C24H17ClFN3O3 — CID 135949237
2-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-N-[(4-fluorophenyl)methyl]-3-oxo-4H-quinoxaline-6-carboxamide (PubChem CID 135949237) has the molecular formula C24H17ClFN3O3 and a molecular weight of 449.87 g/mol. Its IUPAC name is 2-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-N-[(4-fluorophenyl)methyl]-3-oxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 2-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-N-[(4-fluorophenyl)methyl]-3-oxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 135949237 |
| Molecular Formula | C24H17ClFN3O3 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-[(Z)-2-(4-chlorophenyl)-2-hydroxyethenyl]-N-[(4-fluorophenyl)methyl]-3-oxo-4H-quinoxaline-6-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc2nc(/C=C(\O)c3ccc(Cl)cc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H17ClFN3O3/c25-17-6-3-15(4-7-17)22(30)12-21-24(32)29-20-11-16(5-10-19(20)28-21)23(31)27-13-14-1-8-18(26)9-2-14/h1-12,30H,13H2,(H,27,31)(H,29,32)/b22-12- |
| InChIKey | HCGFZAOQLHBZAS-UUYOSTAYSA-N |
| XLogP | 4.70 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|