C16H10ClFN2O2 — CID 135493821
7-chloro-3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-quinoxalin-2-one (PubChem CID 135493821) has the molecular formula C16H10ClFN2O2 and a molecular weight of 316.72 g/mol. Its IUPAC name is 7-chloro-3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-quinoxalin-2-one.
| Compound Name | 7-chloro-3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 135493821 |
| Molecular Formula | C16H10ClFN2O2 |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 7-chloro-3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)ccc2nc1/C=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H10ClFN2O2/c17-10-3-6-12-13(7-10)20-16(22)14(19-12)8-15(21)9-1-4-11(18)5-2-9/h1-8,21H,(H,20,22)/b15-8- |
| InChIKey | PHSGJGIHLYJXBZ-NVNXTCNLSA-N |
| XLogP | 3.77 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|