C15H10FN3O2 — CID 135580950
3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 135580950) has the molecular formula C15H10FN3O2 and a molecular weight of 283.26 g/mol. Its IUPAC name is 3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 135580950 |
| Molecular Formula | C15H10FN3O2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[(Z)-2-(4-fluorophenyl)-2-hydroxyethenyl]-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2cccnc2nc1/C=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FN3O2/c16-10-5-3-9(4-6-10)13(20)8-12-15(21)19-11-2-1-7-17-14(11)18-12/h1-8,20H,(H,19,21)/b13-8- |
| InChIKey | BEDMZKVHZQOZNO-JYRVWZFOSA-N |
| XLogP | 2.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|