About CID 59368109
CID 59368109 (PubChem CID 59368109) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol.
Molecular Properties
| Compound Name | CID 59368109 |
| PubChem CID | 59368109 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | — |
| SMILES | [CH]c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C7H5N3/c1-5-9-6-3-2-4-8-7(6)10-5/h1-4H,(H,8,9,10) |
| InChIKey | OERLOMJPCYABBN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59368109 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59368109?
The IUPAC name of CID 59368109 (CID 59368109) is not available.
What is the SMILES notation for CID 59368109?
The canonical SMILES for CID 59368109 is [CH]c1nc2ncccc2[nH]1.
What is the InChIKey of CID 59368109?
The InChIKey is OERLOMJPCYABBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-5-9-6-3-2-4-8-7(6)10-5/h1-4H,(H,8,9,10).
What are the key properties of CID 59368109?
CID 59368109 has a molecular weight of 131.14 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59368109 is sourced from PubChem (CID 59368109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).