C6H12Cl4N4O — CID 141030571
1H-imidazo[4,5-b]pyridin-2-amine;hydrate;tetrahydrochloride (PubChem CID 141030571) has the molecular formula C6H12Cl4N4O and a molecular weight of 298.00 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridin-2-amine;hydrate;tetrahydrochloride.
| Compound Name | 1H-imidazo[4,5-b]pyridin-2-amine;hydrate;tetrahydrochloride |
|---|---|
| PubChem CID | 141030571 |
| Molecular Formula | C6H12Cl4N4O |
| Molecular Weight | 298.00 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridin-2-amine;hydrate;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Nc1nc2ncccc2[nH]1.O |
| InChI | InChI=1S/C6H6N4.4ClH.H2O/c7-6-9-4-2-1-3-8-5(4)10-6;;;;;/h1-3H,(H3,7,8,9,10);4*1H;1H2 |
| InChIKey | FWVDIQSYYDAPMI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.00 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |