C12H10N4O — CID 136712580
2-amino-6-(1H-imidazo[4,5-b]pyridin-2-yl)phenol (PubChem CID 136712580) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-amino-6-(1H-imidazo[4,5-b]pyridin-2-yl)phenol.
| Compound Name | 2-amino-6-(1H-imidazo[4,5-b]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 136712580 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-amino-6-(1H-imidazo[4,5-b]pyridin-2-yl)phenol |
| SMILES | Nc1cccc(-c2nc3ncccc3[nH]2)c1O |
| InChI | InChI=1S/C12H10N4O/c13-8-4-1-3-7(10(8)17)11-15-9-5-2-6-14-12(9)16-11/h1-6,17H,13H2,(H,14,15,16) |
| InChIKey | ZQGGYBDFGYPBOY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|