About 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide
2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide (PubChem CID 69046529) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide |
| PubChem CID | 69046529 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide |
| SMILES | NC(=O)c1ccccc1-c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C13H10N4O/c14-11(18)8-4-1-2-5-9(8)12-16-10-6-3-7-15-13(10)17-12/h1-7H,(H2,14,18)(H,15,16,17) |
| InChIKey | GCCJGQMZVDIDPX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide?
The IUPAC name of 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide (CID 69046529) is 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide.
What is the SMILES notation for 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide?
The canonical SMILES for 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide is NC(=O)c1ccccc1-c1nc2ncccc2[nH]1.
What is the InChIKey of 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide?
The InChIKey is GCCJGQMZVDIDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c14-11(18)8-4-1-2-5-9(8)12-16-10-6-3-7-15-13(10)17-12/h1-7H,(H2,14,18)(H,15,16,17).
What are the key properties of 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide?
2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide has a molecular weight of 238.25 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazo[4,5-b]pyridin-2-yl)benzamide is sourced from PubChem (CID 69046529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).