About 2-(1H-benzimidazol-2-yl)benzoate;copper(1+)
2-(1H-benzimidazol-2-yl)benzoate;copper(1+) (PubChem CID 174857588) has the molecular formula C14H9CuN2O2
and a molecular weight of 300.78 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)benzoate;copper(1+).
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) |
| PubChem CID | 174857588 |
| Molecular Formula | C14H9CuN2O2 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) |
| SMILES | O=C([O-])c1ccccc1-c1nc2ccccc2[nH]1.[Cu+] |
| InChI | InChI=1S/C14H10N2O2.Cu/c17-14(18)10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13;/h1-8H,(H,15,16)(H,17,18);/q;+1/p-1 |
| InChIKey | OGAIYIPXAKODKA-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-2-yl)benzoate;copper(1+)?
The IUPAC name of 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) (CID 174857588) is 2-(1H-benzimidazol-2-yl)benzoate;copper(1+).
What is the SMILES notation for 2-(1H-benzimidazol-2-yl)benzoate;copper(1+)?
The canonical SMILES for 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) is O=C([O-])c1ccccc1-c1nc2ccccc2[nH]1.[Cu+].
What is the InChIKey of 2-(1H-benzimidazol-2-yl)benzoate;copper(1+)?
The InChIKey is OGAIYIPXAKODKA-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H10N2O2.Cu/c17-14(18)10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13;/h1-8H,(H,15,16)(H,17,18);/q;+1/p-1.
What are the key properties of 2-(1H-benzimidazol-2-yl)benzoate;copper(1+)?
2-(1H-benzimidazol-2-yl)benzoate;copper(1+) has a molecular weight of 300.78 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-2-yl)benzoate;copper(1+) is sourced from PubChem (CID 174857588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).