About bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+)
bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) (PubChem CID 139068471) has the molecular formula C26H18CoN4O2
and a molecular weight of 477.39 g/mol. Its IUPAC name is bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+).
Molecular Properties
| Compound Name | bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) |
| PubChem CID | 139068471 |
| Molecular Formula | C26H18CoN4O2 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) |
| SMILES | [Co+2].[O-]c1ccccc1-c1nc2ccccc2[nH]1.[O-]c1ccccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/2C13H10N2O.Co/c2*16-12-8-4-1-5-9(12)13-14-10-6-2-3-7-11(10)15-13;/h2*1-8,16H,(H,14,15);/q;;+2/p-2 |
| InChIKey | ISNALRDVNIBSBL-UHFFFAOYSA-L |
| XLogP | 4.60 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+)?
The IUPAC name of bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) (CID 139068471) is bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+).
What is the SMILES notation for bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+)?
The canonical SMILES for bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) is [Co+2].[O-]c1ccccc1-c1nc2ccccc2[nH]1.[O-]c1ccccc1-c1nc2ccccc2[nH]1.
What is the InChIKey of bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+)?
The InChIKey is ISNALRDVNIBSBL-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H10N2O.Co/c2*16-12-8-4-1-5-9(12)13-14-10-6-2-3-7-11(10)15-13;/h2*1-8,16H,(H,14,15);/q;;+2/p-2.
What are the key properties of bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+)?
bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) has a molecular weight of 477.39 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(1H-benzimidazol-2-yl)phenolate);cobalt(2+) is sourced from PubChem (CID 139068471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).