C9H7N3O3 — CID 140579352
2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzamide (PubChem CID 140579352) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzamide.
| Compound Name | 2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 140579352 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzamide |
| SMILES | NC(=O)c1ccccc1-c1noc(=O)[nH]1 |
| InChI | InChI=1S/C9H7N3O3/c10-7(13)5-3-1-2-4-6(5)8-11-9(14)15-12-8/h1-4H,(H2,10,13)(H,11,12,14) |
| InChIKey | MTVFJHKDNMIRQR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |