C15H11N3O3 — CID 167966446
4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-N-phenylbenzamide (PubChem CID 167966446) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-N-phenylbenzamide.
| Compound Name | 4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 167966446 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2noc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C15H11N3O3/c19-14(16-12-4-2-1-3-5-12)11-8-6-10(7-9-11)13-17-15(20)21-18-13/h1-9H,(H,16,19)(H,17,18,20) |
| InChIKey | UHMUGYRDHQCORK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |