About molecular hydrogen;N-phenylbenzamide
molecular hydrogen;N-phenylbenzamide (PubChem CID 145238042) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is molecular hydrogen;N-phenylbenzamide.
Molecular Properties
| Compound Name | molecular hydrogen;N-phenylbenzamide |
| PubChem CID | 145238042 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | molecular hydrogen;N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccccc1.[H][H] |
| InChI | InChI=1S/C13H11NO.H2/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12;/h1-10H,(H,14,15);1H |
| InChIKey | WMOHBWMPKNPVOZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;N-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-phenylbenzamide?
The IUPAC name of molecular hydrogen;N-phenylbenzamide (CID 145238042) is molecular hydrogen;N-phenylbenzamide.
What is the SMILES notation for molecular hydrogen;N-phenylbenzamide?
The canonical SMILES for molecular hydrogen;N-phenylbenzamide is O=C(Nc1ccccc1)c1ccccc1.[H][H].
What is the InChIKey of molecular hydrogen;N-phenylbenzamide?
The InChIKey is WMOHBWMPKNPVOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.H2/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12;/h1-10H,(H,14,15);1H.
What are the key properties of molecular hydrogen;N-phenylbenzamide?
molecular hydrogen;N-phenylbenzamide has a molecular weight of 199.25 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-phenylbenzamide is sourced from PubChem (CID 145238042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).