C27H21N3O3 — CID 17340966
3,5-dibenzamido-N-phenylbenzamide (PubChem CID 17340966) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3,5-dibenzamido-N-phenylbenzamide.
| Compound Name | 3,5-dibenzamido-N-phenylbenzamide |
|---|---|
| PubChem CID | 17340966 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3,5-dibenzamido-N-phenylbenzamide |
| SMILES | O=C(Nc1cc(NC(=O)c2ccccc2)cc(C(=O)Nc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O3/c31-25(19-10-4-1-5-11-19)29-23-16-21(27(33)28-22-14-8-3-9-15-22)17-24(18-23)30-26(32)20-12-6-2-7-13-20/h1-18H,(H,28,33)(H,29,31)(H,30,32) |
| InChIKey | DSTUPYREYGSCBG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |