C27H19I2N3O3 — CID 3501081
5-benzamido-1-N,3-N-bis(3-iodophenyl)benzene-1,3-dicarboxamide (PubChem CID 3501081) has the molecular formula C27H19I2N3O3 and a molecular weight of 687.28 g/mol. Its IUPAC name is 5-benzamido-1-N,3-N-bis(3-iodophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-benzamido-1-N,3-N-bis(3-iodophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3501081 |
| Molecular Formula | C27H19I2N3O3 |
| Molecular Weight | 687.28 g/mol |
| Exact Mass | 686.95 |
| IUPAC Name | 5-benzamido-1-N,3-N-bis(3-iodophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1cc(C(=O)Nc2cccc(I)c2)cc(C(=O)Nc2cccc(I)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H19I2N3O3/c28-20-8-4-10-22(15-20)30-26(34)18-12-19(27(35)31-23-11-5-9-21(29)16-23)14-24(13-18)32-25(33)17-6-2-1-3-7-17/h1-16H,(H,30,34)(H,31,35)(H,32,33) |
| InChIKey | JTWHIGRTIXKACI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.28 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|