C13H12IN3O — CID 61095528
3,5-diamino-N-(3-iodophenyl)benzamide (PubChem CID 61095528) has the molecular formula C13H12IN3O and a molecular weight of 353.16 g/mol. Its IUPAC name is 3,5-diamino-N-(3-iodophenyl)benzamide.
| Compound Name | 3,5-diamino-N-(3-iodophenyl)benzamide |
|---|---|
| PubChem CID | 61095528 |
| Molecular Formula | C13H12IN3O |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3,5-diamino-N-(3-iodophenyl)benzamide |
| SMILES | Nc1cc(N)cc(C(=O)Nc2cccc(I)c2)c1 |
| InChI | InChI=1S/C13H12IN3O/c14-9-2-1-3-12(6-9)17-13(18)8-4-10(15)7-11(16)5-8/h1-7H,15-16H2,(H,17,18) |
| InChIKey | BEZPPJZSJQZTLB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|