C48H33N3O12 — CID 118047331
[4-[[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]benzoyl]amino]phenyl] phenyl carbonate (PubChem CID 118047331) has the molecular formula C48H33N3O12 and a molecular weight of 843.80 g/mol. Its IUPAC name is [4-[[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]benzoyl]amino]phenyl] phenyl carbonate.
| Compound Name | [4-[[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]benzoyl]amino]phenyl] phenyl carbonate |
|---|---|
| PubChem CID | 118047331 |
| Molecular Formula | C48H33N3O12 |
| Molecular Weight | 843.80 g/mol |
| Exact Mass | 843.21 |
| IUPAC Name | [4-[[3,5-bis[(4-phenoxycarbonyloxybenzoyl)amino]benzoyl]amino]phenyl] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)Oc1ccc(NC(=O)c2cc(NC(=O)c3ccc(OC(=O)Oc4ccccc4)cc3)cc(NC(=O)c3ccc(OC(=O)Oc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C48H33N3O12/c52-43(31-16-22-40(23-17-31)61-46(55)58-37-10-4-1-5-11-37)50-35-28-33(45(54)49-34-20-26-42(27-21-34)63-48(57)60-39-14-8-3-9-15-39)29-36(30-35)51-44(53)32-18-24-41(25-19-32)62-47(56)59-38-12-6-2-7-13-38/h1-30H,(H,49,54)(H,50,52)(H,51,53) |
| InChIKey | MASITMXFEAKPQR-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.80 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|