About (4-benzamidophenyl) benzoate
(4-benzamidophenyl) benzoate (PubChem CID 569583) has the molecular formula C20H15NO3
and a molecular weight of 317.34 g/mol. Its IUPAC name is (4-benzamidophenyl) benzoate.
Molecular Properties
| Compound Name | (4-benzamidophenyl) benzoate |
| PubChem CID | 569583 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (4-benzamidophenyl) benzoate |
| SMILES | O=C(Nc1ccc(OC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H15NO3/c22-19(15-7-3-1-4-8-15)21-17-11-13-18(14-12-17)24-20(23)16-9-5-2-6-10-16/h1-14H,(H,21,22) |
| InChIKey | GDZHBHHTCMWMJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-benzamidophenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzamidophenyl) benzoate?
The IUPAC name of (4-benzamidophenyl) benzoate (CID 569583) is (4-benzamidophenyl) benzoate.
What is the SMILES notation for (4-benzamidophenyl) benzoate?
The canonical SMILES for (4-benzamidophenyl) benzoate is O=C(Nc1ccc(OC(=O)c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of (4-benzamidophenyl) benzoate?
The InChIKey is GDZHBHHTCMWMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO3/c22-19(15-7-3-1-4-8-15)21-17-11-13-18(14-12-17)24-20(23)16-9-5-2-6-10-16/h1-14H,(H,21,22).
What are the key properties of (4-benzamidophenyl) benzoate?
(4-benzamidophenyl) benzoate has a molecular weight of 317.34 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzamidophenyl) benzoate is sourced from PubChem (CID 569583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).