C22H17NO5 — CID 26665414
(4-benzamidophenyl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 26665414) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is (4-benzamidophenyl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | (4-benzamidophenyl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 26665414 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (4-benzamidophenyl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)c2ccc3c(c2)OCCO3)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NO5/c24-21(15-4-2-1-3-5-15)23-17-7-9-18(10-8-17)28-22(25)16-6-11-19-20(14-16)27-13-12-26-19/h1-11,14H,12-13H2,(H,23,24) |
| InChIKey | HWNKYCFLFSZPFR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|