C25H24N2O4 — CID 35189238
(4-benzamidophenyl) 3-(2,2-dimethylpropanoylamino)benzoate (PubChem CID 35189238) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is (4-benzamidophenyl) 3-(2,2-dimethylpropanoylamino)benzoate.
| Compound Name | (4-benzamidophenyl) 3-(2,2-dimethylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 35189238 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (4-benzamidophenyl) 3-(2,2-dimethylpropanoylamino)benzoate |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)Oc2ccc(NC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-25(2,3)24(30)27-20-11-7-10-18(16-20)23(29)31-21-14-12-19(13-15-21)26-22(28)17-8-5-4-6-9-17/h4-16H,1-3H3,(H,26,28)(H,27,30) |
| InChIKey | NCTZPOJBTGWNII-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|