C22H24N2O4 — CID 35435866
[4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,2-dimethylpropanoylamino)benzoate (PubChem CID 35435866) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,2-dimethylpropanoylamino)benzoate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,2-dimethylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 35435866 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,2-dimethylpropanoylamino)benzoate |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)Oc2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-22(2,3)21(27)23-16-7-4-6-15(14-16)20(26)28-18-11-9-17(10-12-18)24-13-5-8-19(24)25/h4,6-7,9-12,14H,5,8,13H2,1-3H3,(H,23,27) |
| InChIKey | LGOYGSUSZNFKAJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|