C15H14N2O4 — CID 51218356
[4-(2-oxopyrrolidin-1-yl)phenyl] 5-methyl-1,2-oxazole-3-carboxylate (PubChem CID 51218356) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 5-methyl-1,2-oxazole-3-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 5-methyl-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 51218356 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 5-methyl-1,2-oxazole-3-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2ccc(N3CCCC3=O)cc2)no1 |
| InChI | InChI=1S/C15H14N2O4/c1-10-9-13(16-21-10)15(19)20-12-6-4-11(5-7-12)17-8-2-3-14(17)18/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | GQDLCIMYCUHJSX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|