C18H16FNO3 — CID 33089114
[4-(2-oxopyrrolidin-1-yl)phenyl] 5-fluoro-2-methylbenzoate (PubChem CID 33089114) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 5-fluoro-2-methylbenzoate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 5-fluoro-2-methylbenzoate |
|---|---|
| PubChem CID | 33089114 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 5-fluoro-2-methylbenzoate |
| SMILES | Cc1ccc(F)cc1C(=O)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H16FNO3/c1-12-4-5-13(19)11-16(12)18(22)23-15-8-6-14(7-9-15)20-10-2-3-17(20)21/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | DTIBGJGWPLDGAU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|