C21H18FN3O3 — CID 134026276
[4-(2-oxopyrrolidin-1-yl)phenyl] 1-(2-fluorophenyl)-5-methylpyrazole-4-carboxylate (PubChem CID 134026276) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 1-(2-fluorophenyl)-5-methylpyrazole-4-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 1-(2-fluorophenyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134026276 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 1-(2-fluorophenyl)-5-methylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc(N3CCCC3=O)cc2)cnn1-c1ccccc1F |
| InChI | InChI=1S/C21H18FN3O3/c1-14-17(13-23-25(14)19-6-3-2-5-18(19)22)21(27)28-16-10-8-15(9-11-16)24-12-4-7-20(24)26/h2-3,5-6,8-11,13H,4,7,12H2,1H3 |
| InChIKey | NSODZDXECIKHRX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|